C13H17Cl2NO2 — CID 13349850
ethyl 3-[(Z)-1,4-dichlorobut-1-enyl]-4,5-dimethyl-1H-pyrrole-2-carboxylate (PubChem CID 13349850) has the molecular formula C13H17Cl2NO2 and a molecular weight of 290.19 g/mol. Its IUPAC name is ethyl 3-[(Z)-1,4-dichlorobut-1-enyl]-4,5-dimethyl-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 3-[(Z)-1,4-dichlorobut-1-enyl]-4,5-dimethyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 13349850 |
| Molecular Formula | C13H17Cl2NO2 |
| Molecular Weight | 290.19 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | ethyl 3-[(Z)-1,4-dichlorobut-1-enyl]-4,5-dimethyl-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c(C)c(C)c1/C(Cl)=C/CCCl |
| InChI | InChI=1S/C13H17Cl2NO2/c1-4-18-13(17)12-11(8(2)9(3)16-12)10(15)6-5-7-14/h6,16H,4-5,7H2,1-3H3/b10-6- |
| InChIKey | MDLKIKMOFIUWEA-POHAHGRESA-N |
| XLogP | 4.02 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.19 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|