C19H30ClNO2 — CID 5362859
ethyl 4-[(Z)-1-chlorodec-1-enyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate (PubChem CID 5362859) has the molecular formula C19H30ClNO2 and a molecular weight of 339.91 g/mol. Its IUPAC name is ethyl 4-[(Z)-1-chlorodec-1-enyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 4-[(Z)-1-chlorodec-1-enyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 5362859 |
| Molecular Formula | C19H30ClNO2 |
| Molecular Weight | 339.91 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | ethyl 4-[(Z)-1-chlorodec-1-enyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| SMILES | CCCCCCCC/C=C(\Cl)c1c(C)[nH]c(C(=O)OCC)c1C |
| InChI | InChI=1S/C19H30ClNO2/c1-5-7-8-9-10-11-12-13-16(20)17-14(3)18(21-15(17)4)19(22)23-6-2/h13,21H,5-12H2,1-4H3/b16-13- |
| InChIKey | MGQVHIJOSALRQZ-SSZFMOIBSA-N |
| XLogP | 6.14 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.91 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|