C15H15NO5 — CID 13351919
diethyl 1-oxidoquinolin-1-ium-2,3-dicarboxylate (PubChem CID 13351919) has the molecular formula C15H15NO5 and a molecular weight of 289.29 g/mol. Its IUPAC name is diethyl 1-oxidoquinolin-1-ium-2,3-dicarboxylate.
| Compound Name | diethyl 1-oxidoquinolin-1-ium-2,3-dicarboxylate |
|---|---|
| PubChem CID | 13351919 |
| Molecular Formula | C15H15NO5 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | diethyl 1-oxidoquinolin-1-ium-2,3-dicarboxylate |
| SMILES | CCOC(=O)c1cc2ccccc2[n+]([O-])c1C(=O)OCC |
| InChI | InChI=1S/C15H15NO5/c1-3-20-14(17)11-9-10-7-5-6-8-12(10)16(19)13(11)15(18)21-4-2/h5-9H,3-4H2,1-2H3 |
| InChIKey | MAXWQMCOMRPOJK-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 79.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|