About methyl oct-1-en-3-yl carbonate
methyl oct-1-en-3-yl carbonate (PubChem CID 13355103) has the molecular formula C10H18O3
and a molecular weight of 186.25 g/mol. Its IUPAC name is methyl oct-1-en-3-yl carbonate.
Molecular Properties
| Compound Name | methyl oct-1-en-3-yl carbonate |
| PubChem CID | 13355103 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | methyl oct-1-en-3-yl carbonate |
| SMILES | C=CC(CCCCC)OC(=O)OC |
| InChI | InChI=1S/C10H18O3/c1-4-6-7-8-9(5-2)13-10(11)12-3/h5,9H,2,4,6-8H2,1,3H3 |
| InChIKey | HZRJEXYAHMPECV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl oct-1-en-3-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl oct-1-en-3-yl carbonate?
The IUPAC name of methyl oct-1-en-3-yl carbonate (CID 13355103) is methyl oct-1-en-3-yl carbonate.
What is the SMILES notation for methyl oct-1-en-3-yl carbonate?
The canonical SMILES for methyl oct-1-en-3-yl carbonate is C=CC(CCCCC)OC(=O)OC.
What is the InChIKey of methyl oct-1-en-3-yl carbonate?
The InChIKey is HZRJEXYAHMPECV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O3/c1-4-6-7-8-9(5-2)13-10(11)12-3/h5,9H,2,4,6-8H2,1,3H3.
What are the key properties of methyl oct-1-en-3-yl carbonate?
methyl oct-1-en-3-yl carbonate has a molecular weight of 186.25 g/mol, XLogP of 2.90, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl oct-1-en-3-yl carbonate is sourced from PubChem (CID 13355103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).