C8H8ClN3O3S — CID 13389078
methyl 2-(6-amino-3-chloro-5-formylpyrazin-2-yl)sulfanylacetate (PubChem CID 13389078) has the molecular formula C8H8ClN3O3S and a molecular weight of 261.69 g/mol. Its IUPAC name is methyl 2-(6-amino-3-chloro-5-formylpyrazin-2-yl)sulfanylacetate.
| Compound Name | methyl 2-(6-amino-3-chloro-5-formylpyrazin-2-yl)sulfanylacetate |
|---|---|
| PubChem CID | 13389078 |
| Molecular Formula | C8H8ClN3O3S |
| Molecular Weight | 261.69 g/mol |
| Exact Mass | 261.00 |
| IUPAC Name | methyl 2-(6-amino-3-chloro-5-formylpyrazin-2-yl)sulfanylacetate |
| SMILES | COC(=O)CSc1nc(N)c(C=O)nc1Cl |
| InChI | InChI=1S/C8H8ClN3O3S/c1-15-5(14)3-16-8-6(9)11-4(2-13)7(10)12-8/h2H,3H2,1H3,(H2,10,12) |
| InChIKey | VHQSYSAAFHNURN-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.69 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|