C12H13N3O4S — CID 3396473
ethyl 2-amino-5-cyano-6-(2-methoxy-2-oxoethyl)sulfanylpyridine-3-carboxylate (PubChem CID 3396473) has the molecular formula C12H13N3O4S and a molecular weight of 295.32 g/mol. Its IUPAC name is ethyl 2-amino-5-cyano-6-(2-methoxy-2-oxoethyl)sulfanylpyridine-3-carboxylate.
| Compound Name | ethyl 2-amino-5-cyano-6-(2-methoxy-2-oxoethyl)sulfanylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 3396473 |
| Molecular Formula | C12H13N3O4S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | ethyl 2-amino-5-cyano-6-(2-methoxy-2-oxoethyl)sulfanylpyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cc(C#N)c(SCC(=O)OC)nc1N |
| InChI | InChI=1S/C12H13N3O4S/c1-3-19-12(17)8-4-7(5-13)11(15-10(8)14)20-6-9(16)18-2/h4H,3,6H2,1-2H3,(H2,14,15) |
| InChIKey | PFJNWRFEVGQWEC-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 115.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |