C7H8Cl2N2P2 — CID 13397211
3,5-dichloro-1-phenyl-1,2,3,5-diazadiphospholidine (PubChem CID 13397211) has the molecular formula C7H8Cl2N2P2 and a molecular weight of 253.01 g/mol. Its IUPAC name is 3,5-dichloro-1-phenyl-1,2,3,5-diazadiphospholidine.
| Compound Name | 3,5-dichloro-1-phenyl-1,2,3,5-diazadiphospholidine |
|---|---|
| PubChem CID | 13397211 |
| Molecular Formula | C7H8Cl2N2P2 |
| Molecular Weight | 253.01 g/mol |
| Exact Mass | 251.95 |
| IUPAC Name | 3,5-dichloro-1-phenyl-1,2,3,5-diazadiphospholidine |
| SMILES | ClP1CP(Cl)N(c2ccccc2)N1 |
| InChI | InChI=1S/C7H8Cl2N2P2/c8-12-6-13(9)11(10-12)7-4-2-1-3-5-7/h1-5,10H,6H2 |
| InChIKey | KLWZODFWZXYPBR-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.01 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|