C7H6N2P2 — CID 13397213
1-phenyl-1,2,3,5-diazadiphosphole (PubChem CID 13397213) has the molecular formula C7H6N2P2 and a molecular weight of 180.09 g/mol. Its IUPAC name is 1-phenyl-1,2,3,5-diazadiphosphole.
| Compound Name | 1-phenyl-1,2,3,5-diazadiphosphole |
|---|---|
| PubChem CID | 13397213 |
| Molecular Formula | C7H6N2P2 |
| Molecular Weight | 180.09 g/mol |
| Exact Mass | 180.00 |
| IUPAC Name | 1-phenyl-1,2,3,5-diazadiphosphole |
| SMILES | c1ccc(-n2npcp2)cc1 |
| InChI | InChI=1S/C7H6N2P2/c1-2-4-7(5-3-1)9-8-10-6-11-9/h1-6H |
| InChIKey | UVYUEBMOZHLGGM-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.09 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |