C9H14N2O2P2 — CID 13397214
3,5-dimethoxy-1-phenyl-1,2,3,5-diazadiphospholidine (PubChem CID 13397214) has the molecular formula C9H14N2O2P2 and a molecular weight of 244.17 g/mol. Its IUPAC name is 3,5-dimethoxy-1-phenyl-1,2,3,5-diazadiphospholidine.
| Compound Name | 3,5-dimethoxy-1-phenyl-1,2,3,5-diazadiphospholidine |
|---|---|
| PubChem CID | 13397214 |
| Molecular Formula | C9H14N2O2P2 |
| Molecular Weight | 244.17 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 3,5-dimethoxy-1-phenyl-1,2,3,5-diazadiphospholidine |
| SMILES | COP1CP(OC)N(c2ccccc2)N1 |
| InChI | InChI=1S/C9H14N2O2P2/c1-12-14-8-15(13-2)11(10-14)9-6-4-3-5-7-9/h3-7,10H,8H2,1-2H3 |
| InChIKey | ANBSQXIZSBIPKU-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.17 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|