C15H28N4P2 — CID 13397215
3-N,3-N,5-N,5-N-tetraethyl-1-phenyl-1,2,3,5-diazadiphospholidine-3,5-diamine (PubChem CID 13397215) has the molecular formula C15H28N4P2 and a molecular weight of 326.36 g/mol. Its IUPAC name is 3-N,3-N,5-N,5-N-tetraethyl-1-phenyl-1,2,3,5-diazadiphospholidine-3,5-diamine.
| Compound Name | 3-N,3-N,5-N,5-N-tetraethyl-1-phenyl-1,2,3,5-diazadiphospholidine-3,5-diamine |
|---|---|
| PubChem CID | 13397215 |
| Molecular Formula | C15H28N4P2 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | 3-N,3-N,5-N,5-N-tetraethyl-1-phenyl-1,2,3,5-diazadiphospholidine-3,5-diamine |
| SMILES | CCN(CC)P1CP(N(CC)CC)N(c2ccccc2)N1 |
| InChI | InChI=1S/C15H28N4P2/c1-5-17(6-2)20-14-21(18(7-3)8-4)19(16-20)15-12-10-9-11-13-15/h9-13,16H,5-8,14H2,1-4H3 |
| InChIKey | LDCXBMQSVFDSLM-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 21.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|