C9H8Cl2O3 — CID 13400957
(3,5-dichloro-1-methyl-6-oxocyclohexa-2,4-dien-1-yl) acetate (PubChem CID 13400957) has the molecular formula C9H8Cl2O3 and a molecular weight of 235.07 g/mol. Its IUPAC name is (3,5-dichloro-1-methyl-6-oxocyclohexa-2,4-dien-1-yl) acetate.
| Compound Name | (3,5-dichloro-1-methyl-6-oxocyclohexa-2,4-dien-1-yl) acetate |
|---|---|
| PubChem CID | 13400957 |
| Molecular Formula | C9H8Cl2O3 |
| Molecular Weight | 235.07 g/mol |
| Exact Mass | 233.99 |
| IUPAC Name | (3,5-dichloro-1-methyl-6-oxocyclohexa-2,4-dien-1-yl) acetate |
| SMILES | CC(=O)OC1(C)C=C(Cl)C=C(Cl)C1=O |
| InChI | InChI=1S/C9H8Cl2O3/c1-5(12)14-9(2)4-6(10)3-7(11)8(9)13/h3-4H,1-2H3 |
| InChIKey | CVPOEXPYPKHEBU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.07 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|