C18H18ClN5O — CID 134012748
N-[(2-chlorophenyl)methyl]-N-methyl-3-phenyl-2-(tetrazol-1-yl)propanamide (PubChem CID 134012748) has the molecular formula C18H18ClN5O and a molecular weight of 355.83 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-N-methyl-3-phenyl-2-(tetrazol-1-yl)propanamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-N-methyl-3-phenyl-2-(tetrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 134012748 |
| Molecular Formula | C18H18ClN5O |
| Molecular Weight | 355.83 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-N-methyl-3-phenyl-2-(tetrazol-1-yl)propanamide |
| SMILES | CN(Cc1ccccc1Cl)C(=O)C(Cc1ccccc1)n1cnnn1 |
| InChI | InChI=1S/C18H18ClN5O/c1-23(12-15-9-5-6-10-16(15)19)18(25)17(24-13-20-21-22-24)11-14-7-3-2-4-8-14/h2-10,13,17H,11-12H2,1H3 |
| InChIKey | QJCPVMOBBIDSDU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.83 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |