1,3-benzothiazol-2-ylmethyl 3-(4-oxocinnolin-1-yl)propanoate

C19H15N3O3S — CID 134015360

IUPAC1,3-benzothiazol-2-ylmethyl 3-(4-oxocinnolin-1-yl)propanoate
SMILESO=C(CCn1ncc(=O)c2ccccc21)OCc1nc2ccccc2s1
InChIInChI=1S/C19H15N3O3S/c23-16-11-20-22(15-7-3-1-5-13(15)16)10-9-19(24)25-12-18-21-14-6-2-4-8-17(14)26-18/h1-8,11H,9-10,12H2
InChIKeyCKMMQSJBHMVBBR-UHFFFAOYSA-N
MW365.41 g/mol
LogP3.14
Rot. Bonds5

About 1,3-benzothiazol-2-ylmethyl 3-(4-oxocinnolin-1-yl)propanoate

1,3-benzothiazol-2-ylmethyl 3-(4-oxocinnolin-1-yl)propanoate (PubChem CID 134015360) has the molecular formula C19H15N3O3S and a molecular weight of 365.41 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl 3-(4-oxocinnolin-1-yl)propanoate.

Molecular Properties

Compound Name1,3-benzothiazol-2-ylmethyl 3-(4-oxocinnolin-1-yl)propanoate
PubChem CID134015360
Molecular FormulaC19H15N3O3S
Molecular Weight365.41 g/mol
Exact Mass365.08
IUPAC Name1,3-benzothiazol-2-ylmethyl 3-(4-oxocinnolin-1-yl)propanoate
SMILESO=C(CCn1ncc(=O)c2ccccc21)OCc1nc2ccccc2s1
InChIInChI=1S/C19H15N3O3S/c23-16-11-20-22(15-7-3-1-5-13(15)16)10-9-19(24)25-12-18-21-14-6-2-4-8-17(14)26-18/h1-8,11H,9-10,12H2
InChIKeyCKMMQSJBHMVBBR-UHFFFAOYSA-N
XLogP3.14
TPSA74.08 Ų
H-Bond Donors
H-Bond Acceptors7
Rotatable Bonds5
Heavy Atoms26
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500365.41
LogP ≤ 53.14
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 107

Analyze 1,3-benzothiazol-2-ylmethyl 3-(4-oxocinnolin-1-yl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,3-benzothiazol-2-ylmethyl 3-(4-oxocinnolin-1-yl)propanoate?
The IUPAC name of 1,3-benzothiazol-2-ylmethyl 3-(4-oxocinnolin-1-yl)propanoate (CID 134015360) is 1,3-benzothiazol-2-ylmethyl 3-(4-oxocinnolin-1-yl)propanoate.
What is the SMILES notation for 1,3-benzothiazol-2-ylmethyl 3-(4-oxocinnolin-1-yl)propanoate?
The canonical SMILES for 1,3-benzothiazol-2-ylmethyl 3-(4-oxocinnolin-1-yl)propanoate is O=C(CCn1ncc(=O)c2ccccc21)OCc1nc2ccccc2s1.
What is the InChIKey of 1,3-benzothiazol-2-ylmethyl 3-(4-oxocinnolin-1-yl)propanoate?
The InChIKey is CKMMQSJBHMVBBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15N3O3S/c23-16-11-20-22(15-7-3-1-5-13(15)16)10-9-19(24)25-12-18-21-14-6-2-4-8-17(14)26-18/h1-8,11H,9-10,12H2.
What are the key properties of 1,3-benzothiazol-2-ylmethyl 3-(4-oxocinnolin-1-yl)propanoate?
1,3-benzothiazol-2-ylmethyl 3-(4-oxocinnolin-1-yl)propanoate has a molecular weight of 365.41 g/mol, XLogP of 3.14, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-benzothiazol-2-ylmethyl 3-(4-oxocinnolin-1-yl)propanoate is sourced from PubChem (CID 134015360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).