C19H15N3O3S — CID 134015360
1,3-benzothiazol-2-ylmethyl 3-(4-oxocinnolin-1-yl)propanoate (PubChem CID 134015360) has the molecular formula C19H15N3O3S and a molecular weight of 365.41 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl 3-(4-oxocinnolin-1-yl)propanoate.
| Compound Name | 1,3-benzothiazol-2-ylmethyl 3-(4-oxocinnolin-1-yl)propanoate |
|---|---|
| PubChem CID | 134015360 |
| Molecular Formula | C19H15N3O3S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | 1,3-benzothiazol-2-ylmethyl 3-(4-oxocinnolin-1-yl)propanoate |
| SMILES | O=C(CCn1ncc(=O)c2ccccc21)OCc1nc2ccccc2s1 |
| InChI | InChI=1S/C19H15N3O3S/c23-16-11-20-22(15-7-3-1-5-13(15)16)10-9-19(24)25-12-18-21-14-6-2-4-8-17(14)26-18/h1-8,11H,9-10,12H2 |
| InChIKey | CKMMQSJBHMVBBR-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |