C16H22ClN3O4S — CID 134043672
5-chloro-N-[2-(3,4-diethoxyphenyl)ethyl]-1-methylimidazole-4-sulfonamide (PubChem CID 134043672) has the molecular formula C16H22ClN3O4S and a molecular weight of 387.89 g/mol. Its IUPAC name is 5-chloro-N-[2-(3,4-diethoxyphenyl)ethyl]-1-methylimidazole-4-sulfonamide.
| Compound Name | 5-chloro-N-[2-(3,4-diethoxyphenyl)ethyl]-1-methylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 134043672 |
| Molecular Formula | C16H22ClN3O4S |
| Molecular Weight | 387.89 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 5-chloro-N-[2-(3,4-diethoxyphenyl)ethyl]-1-methylimidazole-4-sulfonamide |
| SMILES | CCOc1ccc(CCNS(=O)(=O)c2ncn(C)c2Cl)cc1OCC |
| InChI | InChI=1S/C16H22ClN3O4S/c1-4-23-13-7-6-12(10-14(13)24-5-2)8-9-19-25(21,22)16-15(17)20(3)11-18-16/h6-7,10-11,19H,4-5,8-9H2,1-3H3 |
| InChIKey | ATJGQLGWQDWEBQ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.89 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |