C13H16ClN3O3S — CID 60527069
5-chloro-N-[[3-(methoxymethyl)phenyl]methyl]-1-methylimidazole-4-sulfonamide (PubChem CID 60527069) has the molecular formula C13H16ClN3O3S and a molecular weight of 329.81 g/mol. Its IUPAC name is 5-chloro-N-[[3-(methoxymethyl)phenyl]methyl]-1-methylimidazole-4-sulfonamide.
| Compound Name | 5-chloro-N-[[3-(methoxymethyl)phenyl]methyl]-1-methylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 60527069 |
| Molecular Formula | C13H16ClN3O3S |
| Molecular Weight | 329.81 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 5-chloro-N-[[3-(methoxymethyl)phenyl]methyl]-1-methylimidazole-4-sulfonamide |
| SMILES | COCc1cccc(CNS(=O)(=O)c2ncn(C)c2Cl)c1 |
| InChI | InChI=1S/C13H16ClN3O3S/c1-17-9-15-13(12(17)14)21(18,19)16-7-10-4-3-5-11(6-10)8-20-2/h3-6,9,16H,7-8H2,1-2H3 |
| InChIKey | ACMRRWQKGBGUDD-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.81 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |