C10H12ClN5O2S — CID 62847232
5-chloro-1-methyl-N-[(5-methylpyrazin-2-yl)methyl]imidazole-4-sulfonamide (PubChem CID 62847232) has the molecular formula C10H12ClN5O2S and a molecular weight of 301.76 g/mol. Its IUPAC name is 5-chloro-1-methyl-N-[(5-methylpyrazin-2-yl)methyl]imidazole-4-sulfonamide.
| Compound Name | 5-chloro-1-methyl-N-[(5-methylpyrazin-2-yl)methyl]imidazole-4-sulfonamide |
|---|---|
| PubChem CID | 62847232 |
| Molecular Formula | C10H12ClN5O2S |
| Molecular Weight | 301.76 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | 5-chloro-1-methyl-N-[(5-methylpyrazin-2-yl)methyl]imidazole-4-sulfonamide |
| SMILES | Cc1cnc(CNS(=O)(=O)c2ncn(C)c2Cl)cn1 |
| InChI | InChI=1S/C10H12ClN5O2S/c1-7-3-13-8(4-12-7)5-15-19(17,18)10-9(11)16(2)6-14-10/h3-4,6,15H,5H2,1-2H3 |
| InChIKey | YXHOHTKLLZATOK-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.76 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |