C19H20N4O4S — CID 134045208
2-[4-(1H-indol-3-yl)piperidin-1-yl]-5-nitrobenzenesulfonamide (PubChem CID 134045208) has the molecular formula C19H20N4O4S and a molecular weight of 400.46 g/mol. Its IUPAC name is 2-[4-(1H-indol-3-yl)piperidin-1-yl]-5-nitrobenzenesulfonamide.
| Compound Name | 2-[4-(1H-indol-3-yl)piperidin-1-yl]-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 134045208 |
| Molecular Formula | C19H20N4O4S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 2-[4-(1H-indol-3-yl)piperidin-1-yl]-5-nitrobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc([N+](=O)[O-])ccc1N1CCC(c2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C19H20N4O4S/c20-28(26,27)19-11-14(23(24)25)5-6-18(19)22-9-7-13(8-10-22)16-12-21-17-4-2-1-3-15(16)17/h1-6,11-13,21H,7-10H2,(H2,20,26,27) |
| InChIKey | QZCPBFXDHOSWPL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 122.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|