C17H22N6O2 — CID 134046006
N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-3-phenylpyrazolidine-4-carbohydrazide (PubChem CID 134046006) has the molecular formula C17H22N6O2 and a molecular weight of 342.40 g/mol. Its IUPAC name is N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-3-phenylpyrazolidine-4-carbohydrazide.
| Compound Name | N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-3-phenylpyrazolidine-4-carbohydrazide |
|---|---|
| PubChem CID | 134046006 |
| Molecular Formula | C17H22N6O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-3-phenylpyrazolidine-4-carbohydrazide |
| SMILES | Cc1cc(C)n(CC(=O)NNC(=O)C2CNNC2c2ccccc2)n1 |
| InChI | InChI=1S/C17H22N6O2/c1-11-8-12(2)23(22-11)10-15(24)19-21-17(25)14-9-18-20-16(14)13-6-4-3-5-7-13/h3-8,14,16,18,20H,9-10H2,1-2H3,(H,19,24)(H,21,25) |
| InChIKey | LTCDPOANWXNKCP-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 100.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|