C22H27NO3S — CID 134049973
N-methyl-N-[2-(4-methylphenoxy)ethyl]-2-(oxolan-2-ylmethylsulfanyl)benzamide (PubChem CID 134049973) has the molecular formula C22H27NO3S and a molecular weight of 385.53 g/mol. Its IUPAC name is N-methyl-N-[2-(4-methylphenoxy)ethyl]-2-(oxolan-2-ylmethylsulfanyl)benzamide.
| Compound Name | N-methyl-N-[2-(4-methylphenoxy)ethyl]-2-(oxolan-2-ylmethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 134049973 |
| Molecular Formula | C22H27NO3S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | N-methyl-N-[2-(4-methylphenoxy)ethyl]-2-(oxolan-2-ylmethylsulfanyl)benzamide |
| SMILES | Cc1ccc(OCCN(C)C(=O)c2ccccc2SCC2CCCO2)cc1 |
| InChI | InChI=1S/C22H27NO3S/c1-17-9-11-18(12-10-17)26-15-13-23(2)22(24)20-7-3-4-8-21(20)27-16-19-6-5-14-25-19/h3-4,7-12,19H,5-6,13-16H2,1-2H3 |
| InChIKey | ZKSDQYZWFVVKAU-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |