C21H18N4O2 — CID 134056288
(E)-3-(4-acetamidophenyl)-N-(2-phenylpyrimidin-5-yl)prop-2-enamide (PubChem CID 134056288) has the molecular formula C21H18N4O2 and a molecular weight of 358.40 g/mol. Its IUPAC name is (E)-3-(4-acetamidophenyl)-N-(2-phenylpyrimidin-5-yl)prop-2-enamide.
| Compound Name | (E)-3-(4-acetamidophenyl)-N-(2-phenylpyrimidin-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 134056288 |
| Molecular Formula | C21H18N4O2 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | (E)-3-(4-acetamidophenyl)-N-(2-phenylpyrimidin-5-yl)prop-2-enamide |
| SMILES | CC(=O)Nc1ccc(/C=C/C(=O)Nc2cnc(-c3ccccc3)nc2)cc1 |
| InChI | InChI=1S/C21H18N4O2/c1-15(26)24-18-10-7-16(8-11-18)9-12-20(27)25-19-13-22-21(23-14-19)17-5-3-2-4-6-17/h2-14H,1H3,(H,24,26)(H,25,27)/b12-9+ |
| InChIKey | URPNMKRMXNBPCR-FMIVXFBMSA-N |
| XLogP | 3.75 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|