C32H42MnN8 — CID 134067824
2,11,20,29,38,40-hexaza-37,39-diazanidanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetraconta-4,6,8,22,24,26-hexaene;manganese(2+) (PubChem CID 134067824) has the molecular formula C32H42MnN8 and a molecular weight of 593.68 g/mol. Its IUPAC name is 2,11,20,29,38,40-hexaza-37,39-diazanidanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetraconta-4,6,8,22,24,26-hexaene;manganese(2+).
| Compound Name | 2,11,20,29,38,40-hexaza-37,39-diazanidanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetraconta-4,6,8,22,24,26-hexaene;manganese(2+) |
|---|---|
| PubChem CID | 134067824 |
| Molecular Formula | C32H42MnN8 |
| Molecular Weight | 593.68 g/mol |
| Exact Mass | 593.29 |
| IUPAC Name | 2,11,20,29,38,40-hexaza-37,39-diazanidanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetraconta-4,6,8,22,24,26-hexaene;manganese(2+) |
| SMILES | [Mn+2].c1ccc2c(c1)C1NC2NC2[N-]C(NC3NC(NC4[N-]C(N1)C1CCCCC41)c1ccccc13)C1CCCCC21 |
| InChI | InChI=1S/C32H42N8.Mn/c1-2-10-18-17(9-1)25-33-26(18)38-28-21-13-5-6-14-22(21)30(35-28)40-32-24-16-8-7-15-23(24)31(36-32)39-29-20-12-4-3-11-19(20)27(34-29)37-25;/h1-2,7-10,15-16,19-22,25-33,36-40H,3-6,11-14H2;/q-2;+2 |
| InChIKey | VNDOKIGXKNPURZ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.68 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |