C38H32 — CID 124909591
(12S,13R,18R,19S)-decacyclo[18.6.6.64,11.02,19.03,12.05,10.013,18.021,26.027,32.033,38]octatriaconta-2,5,7,9,21,23,25,27,29,31,33,35,37-tridecaene (PubChem CID 124909591) has the molecular formula C38H32 and a molecular weight of 488.67 g/mol. Its IUPAC name is (12S,13R,18R,19S)-decacyclo[18.6.6.64,11.02,19.03,12.05,10.013,18.021,26.027,32.033,38]octatriaconta-2,5,7,9,21,23,25,27,29,31,33,35,37-tridecaene.
| Compound Name | (12S,13R,18R,19S)-decacyclo[18.6.6.64,11.02,19.03,12.05,10.013,18.021,26.027,32.033,38]octatriaconta-2,5,7,9,21,23,25,27,29,31,33,35,37-tridecaene |
|---|---|
| PubChem CID | 124909591 |
| Molecular Formula | C38H32 |
| Molecular Weight | 488.67 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | (12S,13R,18R,19S)-decacyclo[18.6.6.64,11.02,19.03,12.05,10.013,18.021,26.027,32.033,38]octatriaconta-2,5,7,9,21,23,25,27,29,31,33,35,37-tridecaene |
| SMILES | c1ccc2c(c1)C1C3=C4C5c6ccccc6C(c6ccccc65)[C@@H]4[C@@H]4CCCC[C@H]4[C@H]3C2c2ccccc21 |
| InChI | InChI=1S/C38H32/c1-5-15-25-21(11-1)31-22-12-2-6-16-26(22)33(25)37-35(31)29-19-9-10-20-30(29)36-32-23-13-3-7-17-27(23)34(38(36)37)28-18-8-4-14-24(28)32/h1-8,11-18,29-36H,9-10,19-20H2/t29-,30-,31?,32?,33?,34?,35+,36+/m1/s1 |
| InChIKey | RRBWENYMZIHSCD-CNOADSRKSA-N |
| XLogP | 8.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.67 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|