C17H19BClNO3 — CID 134068214
[2-chloro-4-[[4-(2-methylpropyl)phenyl]carbamoyl]phenyl]boronic acid (PubChem CID 134068214) has the molecular formula C17H19BClNO3 and a molecular weight of 331.61 g/mol. Its IUPAC name is [2-chloro-4-[[4-(2-methylpropyl)phenyl]carbamoyl]phenyl]boronic acid.
| Compound Name | [2-chloro-4-[[4-(2-methylpropyl)phenyl]carbamoyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 134068214 |
| Molecular Formula | C17H19BClNO3 |
| Molecular Weight | 331.61 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | [2-chloro-4-[[4-(2-methylpropyl)phenyl]carbamoyl]phenyl]boronic acid |
| SMILES | CC(C)Cc1ccc(NC(=O)c2ccc(B(O)O)c(Cl)c2)cc1 |
| InChI | InChI=1S/C17H19BClNO3/c1-11(2)9-12-3-6-14(7-4-12)20-17(21)13-5-8-15(18(22)23)16(19)10-13/h3-8,10-11,22-23H,9H2,1-2H3,(H,20,21) |
| InChIKey | XDPMMQKEJKTKDI-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.61 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|