C16H22N4O3S — CID 134068513
(5-methyl-4-nitropyrazolidin-3-yl)-[3-(phenylsulfanylmethyl)pyrrolidin-1-yl]methanone (PubChem CID 134068513) has the molecular formula C16H22N4O3S and a molecular weight of 350.44 g/mol. Its IUPAC name is (5-methyl-4-nitropyrazolidin-3-yl)-[3-(phenylsulfanylmethyl)pyrrolidin-1-yl]methanone.
| Compound Name | (5-methyl-4-nitropyrazolidin-3-yl)-[3-(phenylsulfanylmethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 134068513 |
| Molecular Formula | C16H22N4O3S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | (5-methyl-4-nitropyrazolidin-3-yl)-[3-(phenylsulfanylmethyl)pyrrolidin-1-yl]methanone |
| SMILES | CC1NNC(C(=O)N2CCC(CSc3ccccc3)C2)C1[N+](=O)[O-] |
| InChI | InChI=1S/C16H22N4O3S/c1-11-15(20(22)23)14(18-17-11)16(21)19-8-7-12(9-19)10-24-13-5-3-2-4-6-13/h2-6,11-12,14-15,17-18H,7-10H2,1H3 |
| InChIKey | ADALMHFPAIVHFJ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|