C24H21ClN4 — CID 134083466
1-[1-[(3-chlorophenyl)methyl]benzimidazol-2-yl]-2-(1H-indol-3-yl)ethanamine (PubChem CID 134083466) has the molecular formula C24H21ClN4 and a molecular weight of 400.91 g/mol. Its IUPAC name is 1-[1-[(3-chlorophenyl)methyl]benzimidazol-2-yl]-2-(1H-indol-3-yl)ethanamine.
| Compound Name | 1-[1-[(3-chlorophenyl)methyl]benzimidazol-2-yl]-2-(1H-indol-3-yl)ethanamine |
|---|---|
| PubChem CID | 134083466 |
| Molecular Formula | C24H21ClN4 |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 1-[1-[(3-chlorophenyl)methyl]benzimidazol-2-yl]-2-(1H-indol-3-yl)ethanamine |
| SMILES | NC(Cc1c[nH]c2ccccc12)c1nc2ccccc2n1Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C24H21ClN4/c25-18-7-5-6-16(12-18)15-29-23-11-4-3-10-22(23)28-24(29)20(26)13-17-14-27-21-9-2-1-8-19(17)21/h1-12,14,20,27H,13,15,26H2 |
| InChIKey | JYPFKDNTQJGSHC-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 59.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |