C20H23N3O5S — CID 134084811
4-[2-(2-methoxyethylamino)acetyl]-2-oxo-1-(2-thiophen-2-ylethyl)-3H-quinoxaline-6-carboxylic acid (PubChem CID 134084811) has the molecular formula C20H23N3O5S and a molecular weight of 417.49 g/mol. Its IUPAC name is 4-[2-(2-methoxyethylamino)acetyl]-2-oxo-1-(2-thiophen-2-ylethyl)-3H-quinoxaline-6-carboxylic acid.
| Compound Name | 4-[2-(2-methoxyethylamino)acetyl]-2-oxo-1-(2-thiophen-2-ylethyl)-3H-quinoxaline-6-carboxylic acid |
|---|---|
| PubChem CID | 134084811 |
| Molecular Formula | C20H23N3O5S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 4-[2-(2-methoxyethylamino)acetyl]-2-oxo-1-(2-thiophen-2-ylethyl)-3H-quinoxaline-6-carboxylic acid |
| SMILES | COCCNCC(=O)N1CC(=O)N(CCc2cccs2)c2ccc(C(=O)O)cc21 |
| InChI | InChI=1S/C20H23N3O5S/c1-28-9-7-21-12-18(24)23-13-19(25)22(8-6-15-3-2-10-29-15)16-5-4-14(20(26)27)11-17(16)23/h2-5,10-11,21H,6-9,12-13H2,1H3,(H,26,27) |
| InChIKey | CCROXWMPJMPETP-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|