C24H28N2O4S — CID 134084760
1-butyl-2-oxo-4-[2-(4-propan-2-ylphenyl)sulfanylacetyl]-3H-quinoxaline-6-carboxylic acid (PubChem CID 134084760) has the molecular formula C24H28N2O4S and a molecular weight of 440.57 g/mol. Its IUPAC name is 1-butyl-2-oxo-4-[2-(4-propan-2-ylphenyl)sulfanylacetyl]-3H-quinoxaline-6-carboxylic acid.
| Compound Name | 1-butyl-2-oxo-4-[2-(4-propan-2-ylphenyl)sulfanylacetyl]-3H-quinoxaline-6-carboxylic acid |
|---|---|
| PubChem CID | 134084760 |
| Molecular Formula | C24H28N2O4S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 1-butyl-2-oxo-4-[2-(4-propan-2-ylphenyl)sulfanylacetyl]-3H-quinoxaline-6-carboxylic acid |
| SMILES | CCCCN1C(=O)CN(C(=O)CSc2ccc(C(C)C)cc2)c2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C24H28N2O4S/c1-4-5-12-25-20-11-8-18(24(29)30)13-21(20)26(14-22(25)27)23(28)15-31-19-9-6-17(7-10-19)16(2)3/h6-11,13,16H,4-5,12,14-15H2,1-3H3,(H,29,30) |
| InChIKey | GLRQSAOBWDMHLZ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |