C19H25N3O4S — CID 134084745
1-butyl-2-oxo-4-(2-thiomorpholin-4-ylacetyl)-3H-quinoxaline-6-carboxylic acid (PubChem CID 134084745) has the molecular formula C19H25N3O4S and a molecular weight of 391.49 g/mol. Its IUPAC name is 1-butyl-2-oxo-4-(2-thiomorpholin-4-ylacetyl)-3H-quinoxaline-6-carboxylic acid.
| Compound Name | 1-butyl-2-oxo-4-(2-thiomorpholin-4-ylacetyl)-3H-quinoxaline-6-carboxylic acid |
|---|---|
| PubChem CID | 134084745 |
| Molecular Formula | C19H25N3O4S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 1-butyl-2-oxo-4-(2-thiomorpholin-4-ylacetyl)-3H-quinoxaline-6-carboxylic acid |
| SMILES | CCCCN1C(=O)CN(C(=O)CN2CCSCC2)c2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C19H25N3O4S/c1-2-3-6-21-15-5-4-14(19(25)26)11-16(15)22(13-18(21)24)17(23)12-20-7-9-27-10-8-20/h4-5,11H,2-3,6-10,12-13H2,1H3,(H,25,26) |
| InChIKey | RUUSMCVCWABPGG-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |