C17H23N3O6 — CID 134084825
1-(2-methoxyethyl)-4-[2-(2-methoxyethylamino)acetyl]-2-oxo-3H-quinoxaline-6-carboxylic acid (PubChem CID 134084825) has the molecular formula C17H23N3O6 and a molecular weight of 365.39 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-4-[2-(2-methoxyethylamino)acetyl]-2-oxo-3H-quinoxaline-6-carboxylic acid.
| Compound Name | 1-(2-methoxyethyl)-4-[2-(2-methoxyethylamino)acetyl]-2-oxo-3H-quinoxaline-6-carboxylic acid |
|---|---|
| PubChem CID | 134084825 |
| Molecular Formula | C17H23N3O6 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 1-(2-methoxyethyl)-4-[2-(2-methoxyethylamino)acetyl]-2-oxo-3H-quinoxaline-6-carboxylic acid |
| SMILES | COCCNCC(=O)N1CC(=O)N(CCOC)c2ccc(C(=O)O)cc21 |
| InChI | InChI=1S/C17H23N3O6/c1-25-7-5-18-10-15(21)20-11-16(22)19(6-8-26-2)13-4-3-12(17(23)24)9-14(13)20/h3-4,9,18H,5-8,10-11H2,1-2H3,(H,23,24) |
| InChIKey | VBNNEJNLYZUCLN-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|