C24H26N2O5 — CID 134084897
2-oxo-4-[(E)-3-phenylprop-2-enoyl]-1-(3-propan-2-yloxypropyl)-3H-quinoxaline-6-carboxylic acid (PubChem CID 134084897) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is 2-oxo-4-[(E)-3-phenylprop-2-enoyl]-1-(3-propan-2-yloxypropyl)-3H-quinoxaline-6-carboxylic acid.
| Compound Name | 2-oxo-4-[(E)-3-phenylprop-2-enoyl]-1-(3-propan-2-yloxypropyl)-3H-quinoxaline-6-carboxylic acid |
|---|---|
| PubChem CID | 134084897 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 2-oxo-4-[(E)-3-phenylprop-2-enoyl]-1-(3-propan-2-yloxypropyl)-3H-quinoxaline-6-carboxylic acid |
| SMILES | CC(C)OCCCN1C(=O)CN(C(=O)/C=C/c2ccccc2)c2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C24H26N2O5/c1-17(2)31-14-6-13-25-20-11-10-19(24(29)30)15-21(20)26(16-23(25)28)22(27)12-9-18-7-4-3-5-8-18/h3-5,7-12,15,17H,6,13-14,16H2,1-2H3,(H,29,30)/b12-9+ |
| InChIKey | YBPMOKZNGUJHJV-FMIVXFBMSA-N |
| XLogP | 3.59 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|