C23H22N2O5 — CID 134084889
4-[(E)-3-cyclopropylprop-2-enoyl]-1-[(2-methoxyphenyl)methyl]-2-oxo-3H-quinoxaline-6-carboxylic acid (PubChem CID 134084889) has the molecular formula C23H22N2O5 and a molecular weight of 406.44 g/mol. Its IUPAC name is 4-[(E)-3-cyclopropylprop-2-enoyl]-1-[(2-methoxyphenyl)methyl]-2-oxo-3H-quinoxaline-6-carboxylic acid.
| Compound Name | 4-[(E)-3-cyclopropylprop-2-enoyl]-1-[(2-methoxyphenyl)methyl]-2-oxo-3H-quinoxaline-6-carboxylic acid |
|---|---|
| PubChem CID | 134084889 |
| Molecular Formula | C23H22N2O5 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 4-[(E)-3-cyclopropylprop-2-enoyl]-1-[(2-methoxyphenyl)methyl]-2-oxo-3H-quinoxaline-6-carboxylic acid |
| SMILES | COc1ccccc1CN1C(=O)CN(C(=O)/C=C/C2CC2)c2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C23H22N2O5/c1-30-20-5-3-2-4-17(20)13-24-18-10-9-16(23(28)29)12-19(18)25(14-22(24)27)21(26)11-8-15-6-7-15/h2-5,8-12,15H,6-7,13-14H2,1H3,(H,28,29)/b11-8+ |
| InChIKey | HPSHYAQYAPOPOU-DHZHZOJOSA-N |
| XLogP | 3.24 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|