C19H21ClN2O6 — CID 134090297
N-[(E)-(7-chloro-3',4,6-trimethoxy-5'-methyl-3-oxospiro[1-benzofuran-2,4'-cyclohex-2-ene]-1'-ylidene)amino]acetamide (PubChem CID 134090297) has the molecular formula C19H21ClN2O6 and a molecular weight of 408.84 g/mol. Its IUPAC name is N-[(E)-(7-chloro-3',4,6-trimethoxy-5'-methyl-3-oxospiro[1-benzofuran-2,4'-cyclohex-2-ene]-1'-ylidene)amino]acetamide.
| Compound Name | N-[(E)-(7-chloro-3',4,6-trimethoxy-5'-methyl-3-oxospiro[1-benzofuran-2,4'-cyclohex-2-ene]-1'-ylidene)amino]acetamide |
|---|---|
| PubChem CID | 134090297 |
| Molecular Formula | C19H21ClN2O6 |
| Molecular Weight | 408.84 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | N-[(E)-(7-chloro-3',4,6-trimethoxy-5'-methyl-3-oxospiro[1-benzofuran-2,4'-cyclohex-2-ene]-1'-ylidene)amino]acetamide |
| SMILES | COC1=C/C(=N/NC(C)=O)CC(C)C12Oc1c(Cl)c(OC)cc(OC)c1C2=O |
| InChI | InChI=1S/C19H21ClN2O6/c1-9-6-11(22-21-10(2)23)7-14(27-5)19(9)18(24)15-12(25-3)8-13(26-4)16(20)17(15)28-19/h7-9H,6H2,1-5H3,(H,21,23)/b22-11+ |
| InChIKey | FBVLJVOUYAIQHX-SSDVNMTOSA-N |
| XLogP | 2.73 |
| TPSA | 95.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.84 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|