C9H5Cl2NO3S — CID 134090754
5-(2,4-dichlorophenoxy)-1,3-thiazolidine-2,4-dione (PubChem CID 134090754) has the molecular formula C9H5Cl2NO3S and a molecular weight of 278.12 g/mol. Its IUPAC name is 5-(2,4-dichlorophenoxy)-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-(2,4-dichlorophenoxy)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 134090754 |
| Molecular Formula | C9H5Cl2NO3S |
| Molecular Weight | 278.12 g/mol |
| Exact Mass | 276.94 |
| IUPAC Name | 5-(2,4-dichlorophenoxy)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(Oc2ccc(Cl)cc2Cl)S1 |
| InChI | InChI=1S/C9H5Cl2NO3S/c10-4-1-2-6(5(11)3-4)15-8-7(13)12-9(14)16-8/h1-3,8H,(H,12,13,14) |
| InChIKey | LZIHVCNVUWGCIC-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.12 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|