C10H8Cl2N2O2 — CID 697883
(4R)-4-(2,4-dichlorophenoxy)-3-methyl-1,4-dihydropyrazol-5-one (PubChem CID 697883) has the molecular formula C10H8Cl2N2O2 and a molecular weight of 259.09 g/mol. Its IUPAC name is (4R)-4-(2,4-dichlorophenoxy)-3-methyl-1,4-dihydropyrazol-5-one.
| Compound Name | (4R)-4-(2,4-dichlorophenoxy)-3-methyl-1,4-dihydropyrazol-5-one |
|---|---|
| PubChem CID | 697883 |
| Molecular Formula | C10H8Cl2N2O2 |
| Molecular Weight | 259.09 g/mol |
| Exact Mass | 258.00 |
| IUPAC Name | (4R)-4-(2,4-dichlorophenoxy)-3-methyl-1,4-dihydropyrazol-5-one |
| SMILES | CC1=NNC(=O)[C@@H]1Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H8Cl2N2O2/c1-5-9(10(15)14-13-5)16-8-3-2-6(11)4-7(8)12/h2-4,9H,1H3,(H,14,15)/t9-/m1/s1 |
| InChIKey | AEFIPCCALRQVBQ-SECBINFHSA-N |
| XLogP | 2.25 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.09 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |