C26H27FN4O2S — CID 134096072
N-[1-(4-fluorophenyl)-3-[(4-methylpiperazin-1-yl)methyl]indol-5-yl]benzenesulfonamide (PubChem CID 134096072) has the molecular formula C26H27FN4O2S and a molecular weight of 478.59 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)-3-[(4-methylpiperazin-1-yl)methyl]indol-5-yl]benzenesulfonamide.
| Compound Name | N-[1-(4-fluorophenyl)-3-[(4-methylpiperazin-1-yl)methyl]indol-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 134096072 |
| Molecular Formula | C26H27FN4O2S |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | N-[1-(4-fluorophenyl)-3-[(4-methylpiperazin-1-yl)methyl]indol-5-yl]benzenesulfonamide |
| SMILES | CN1CCN(Cc2cn(-c3ccc(F)cc3)c3ccc(NS(=O)(=O)c4ccccc4)cc23)CC1 |
| InChI | InChI=1S/C26H27FN4O2S/c1-29-13-15-30(16-14-29)18-20-19-31(23-10-7-21(27)8-11-23)26-12-9-22(17-25(20)26)28-34(32,33)24-5-3-2-4-6-24/h2-12,17,19,28H,13-16,18H2,1H3 |
| InChIKey | KJAXGNMRYJXKCS-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |