C17H19ClN4O — CID 134096320
5-[3-(4-chloro-3-methoxyphenyl)-3-methylbut-1-ynyl]-6-methylpyrimidine-2,4-diamine (PubChem CID 134096320) has the molecular formula C17H19ClN4O and a molecular weight of 330.82 g/mol. Its IUPAC name is 5-[3-(4-chloro-3-methoxyphenyl)-3-methylbut-1-ynyl]-6-methylpyrimidine-2,4-diamine.
| Compound Name | 5-[3-(4-chloro-3-methoxyphenyl)-3-methylbut-1-ynyl]-6-methylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 134096320 |
| Molecular Formula | C17H19ClN4O |
| Molecular Weight | 330.82 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 5-[3-(4-chloro-3-methoxyphenyl)-3-methylbut-1-ynyl]-6-methylpyrimidine-2,4-diamine |
| SMILES | COc1cc(C(C)(C)C#Cc2c(C)nc(N)nc2N)ccc1Cl |
| InChI | InChI=1S/C17H19ClN4O/c1-10-12(15(19)22-16(20)21-10)7-8-17(2,3)11-5-6-13(18)14(9-11)23-4/h5-6,9H,1-4H3,(H4,19,20,21,22) |
| InChIKey | WQASXRHFTZFHFI-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.82 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|