C17H20N4 — CID 134104024
6-methyl-5-[3-methyl-3-(4-methylphenyl)but-1-ynyl]pyrimidine-2,4-diamine (PubChem CID 134104024) has the molecular formula C17H20N4 and a molecular weight of 280.38 g/mol. Its IUPAC name is 6-methyl-5-[3-methyl-3-(4-methylphenyl)but-1-ynyl]pyrimidine-2,4-diamine.
| Compound Name | 6-methyl-5-[3-methyl-3-(4-methylphenyl)but-1-ynyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 134104024 |
| Molecular Formula | C17H20N4 |
| Molecular Weight | 280.38 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 6-methyl-5-[3-methyl-3-(4-methylphenyl)but-1-ynyl]pyrimidine-2,4-diamine |
| SMILES | Cc1ccc(C(C)(C)C#Cc2c(C)nc(N)nc2N)cc1 |
| InChI | InChI=1S/C17H20N4/c1-11-5-7-13(8-6-11)17(3,4)10-9-14-12(2)20-16(19)21-15(14)18/h5-8H,1-4H3,(H4,18,19,20,21) |
| InChIKey | MKRXOZCCUYNFGO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.38 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|