C17H18F3N5 — CID 134125725
6-ethyl-5-[3-methyl-3-[5-(trifluoromethyl)-2-pyridinyl]but-1-ynyl]pyrimidine-2,4-diamine (PubChem CID 134125725) has the molecular formula C17H18F3N5 and a molecular weight of 349.36 g/mol. Its IUPAC name is 6-ethyl-5-[3-methyl-3-[5-(trifluoromethyl)-2-pyridinyl]but-1-ynyl]pyrimidine-2,4-diamine.
| Compound Name | 6-ethyl-5-[3-methyl-3-[5-(trifluoromethyl)-2-pyridinyl]but-1-ynyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 134125725 |
| Molecular Formula | C17H18F3N5 |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 6-ethyl-5-[3-methyl-3-[5-(trifluoromethyl)-2-pyridinyl]but-1-ynyl]pyrimidine-2,4-diamine |
| SMILES | CCc1nc(N)nc(N)c1C#CC(C)(C)c1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C17H18F3N5/c1-4-12-11(14(21)25-15(22)24-12)7-8-16(2,3)13-6-5-10(9-23-13)17(18,19)20/h5-6,9H,4H2,1-3H3,(H4,21,22,24,25) |
| InChIKey | PAVGDUYUQPFNPJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|