C15H17N5 — CID 134125729
6-methyl-5-(3-methyl-3-pyridin-2-ylbut-1-ynyl)pyrimidine-2,4-diamine (PubChem CID 134125729) has the molecular formula C15H17N5 and a molecular weight of 267.34 g/mol. Its IUPAC name is 6-methyl-5-(3-methyl-3-pyridin-2-ylbut-1-ynyl)pyrimidine-2,4-diamine.
| Compound Name | 6-methyl-5-(3-methyl-3-pyridin-2-ylbut-1-ynyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 134125729 |
| Molecular Formula | C15H17N5 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 6-methyl-5-(3-methyl-3-pyridin-2-ylbut-1-ynyl)pyrimidine-2,4-diamine |
| SMILES | Cc1nc(N)nc(N)c1C#CC(C)(C)c1ccccn1 |
| InChI | InChI=1S/C15H17N5/c1-10-11(13(16)20-14(17)19-10)7-8-15(2,3)12-6-4-5-9-18-12/h4-6,9H,1-3H3,(H4,16,17,19,20) |
| InChIKey | NSYYOOWBMQYJFC-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|