C9H7Cl2N3O — CID 134097598
1-cyano-3-(2,4-dichlorophenyl)-1-methylurea (PubChem CID 134097598) has the molecular formula C9H7Cl2N3O and a molecular weight of 244.08 g/mol. Its IUPAC name is 1-cyano-3-(2,4-dichlorophenyl)-1-methylurea.
| Compound Name | 1-cyano-3-(2,4-dichlorophenyl)-1-methylurea |
|---|---|
| PubChem CID | 134097598 |
| Molecular Formula | C9H7Cl2N3O |
| Molecular Weight | 244.08 g/mol |
| Exact Mass | 243.00 |
| IUPAC Name | 1-cyano-3-(2,4-dichlorophenyl)-1-methylurea |
| SMILES | CN(C#N)C(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C9H7Cl2N3O/c1-14(5-12)9(15)13-8-3-2-6(10)4-7(8)11/h2-4H,1H3,(H,13,15) |
| InChIKey | URNBPMRDWWOHEK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.08 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|