C16H16Cl2N2 — CID 134098477
1-[(2-chlorophenyl)methyl]-5,7-dimethylimidazo[1,2-a]pyridin-1-ium chloride (PubChem CID 134098477) has the molecular formula C16H16Cl2N2 and a molecular weight of 307.22 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-5,7-dimethylimidazo[1,2-a]pyridin-1-ium chloride.
| Compound Name | 1-[(2-chlorophenyl)methyl]-5,7-dimethylimidazo[1,2-a]pyridin-1-ium chloride |
|---|---|
| PubChem CID | 134098477 |
| Molecular Formula | C16H16Cl2N2 |
| Molecular Weight | 307.22 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-5,7-dimethylimidazo[1,2-a]pyridin-1-ium chloride |
| SMILES | Cc1cc(C)n2cc[n+](Cc3ccccc3Cl)c2c1.[Cl-] |
| InChI | InChI=1S/C16H16ClN2.ClH/c1-12-9-13(2)19-8-7-18(16(19)10-12)11-14-5-3-4-6-15(14)17;/h3-10H,11H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | TWLHDGHEQQTSDW-UHFFFAOYSA-M |
| XLogP | 0.55 |
| TPSA | 8.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.22 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|