C14H15ClN+ — CID 3273362
1-[(2-chlorophenyl)methyl]-2,4-dimethylpyridin-1-ium (PubChem CID 3273362) has the molecular formula C14H15ClN+ and a molecular weight of 232.73 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-2,4-dimethylpyridin-1-ium.
| Compound Name | 1-[(2-chlorophenyl)methyl]-2,4-dimethylpyridin-1-ium |
|---|---|
| PubChem CID | 3273362 |
| Molecular Formula | C14H15ClN+ |
| Molecular Weight | 232.73 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-2,4-dimethylpyridin-1-ium |
| SMILES | Cc1cc[n+](Cc2ccccc2Cl)c(C)c1 |
| InChI | InChI=1S/C14H15ClN/c1-11-7-8-16(12(2)9-11)10-13-5-3-4-6-14(13)15/h3-9H,10H2,1-2H3/q+1 |
| InChIKey | QPXHBUBCJOAJCJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.73 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|