C17H15Cl2N3 — CID 44659341
4-[(2-chlorophenyl)methyl]-2-methyl-3H-imidazo[1,2-a]benzimidazol-4-ium chloride (PubChem CID 44659341) has the molecular formula C17H15Cl2N3 and a molecular weight of 332.23 g/mol. Its IUPAC name is 4-[(2-chlorophenyl)methyl]-2-methyl-3H-imidazo[1,2-a]benzimidazol-4-ium chloride.
| Compound Name | 4-[(2-chlorophenyl)methyl]-2-methyl-3H-imidazo[1,2-a]benzimidazol-4-ium chloride |
|---|---|
| PubChem CID | 44659341 |
| Molecular Formula | C17H15Cl2N3 |
| Molecular Weight | 332.23 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 4-[(2-chlorophenyl)methyl]-2-methyl-3H-imidazo[1,2-a]benzimidazol-4-ium chloride |
| SMILES | Cc1cn2c3ccccc3[n+](Cc3ccccc3Cl)c2[nH]1.[Cl-] |
| InChI | InChI=1S/C17H14ClN3.ClH/c1-12-10-20-15-8-4-5-9-16(15)21(17(20)19-12)11-13-6-2-3-7-14(13)18;/h2-10H,11H2,1H3;1H |
| InChIKey | XZJLRZCWAQZWKU-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 24.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.23 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|