C16H16ClN4O4S+ — CID 4541564
2-[[7-[(2-chlorophenyl)methyl]-1,3-dimethyl-2,6-dioxo-9H-purin-7-ium-8-yl]sulfanyl]acetic acid (PubChem CID 4541564) has the molecular formula C16H16ClN4O4S+ and a molecular weight of 395.85 g/mol. Its IUPAC name is 2-[[7-[(2-chlorophenyl)methyl]-1,3-dimethyl-2,6-dioxo-9H-purin-7-ium-8-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[7-[(2-chlorophenyl)methyl]-1,3-dimethyl-2,6-dioxo-9H-purin-7-ium-8-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 4541564 |
| Molecular Formula | C16H16ClN4O4S+ |
| Molecular Weight | 395.85 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | 2-[[7-[(2-chlorophenyl)methyl]-1,3-dimethyl-2,6-dioxo-9H-purin-7-ium-8-yl]sulfanyl]acetic acid |
| SMILES | Cn1c(=O)c2c([nH]c(SCC(=O)O)[n+]2Cc2ccccc2Cl)n(C)c1=O |
| InChI | InChI=1S/C16H15ClN4O4S/c1-19-13-12(14(24)20(2)16(19)25)21(15(18-13)26-8-11(22)23)7-9-5-3-4-6-10(9)17/h3-6H,7-8H2,1-2H3,(H,22,23)/p+1 |
| InChIKey | HPVKTSPJZNXBMT-UHFFFAOYSA-O |
| XLogP | 0.73 |
| TPSA | 100.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.85 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|