C14H16N5O2+ — CID 4079046
8-anilino-1,3,7-trimethyl-9H-purin-7-ium-2,6-dione (PubChem CID 4079046) has the molecular formula C14H16N5O2+ and a molecular weight of 286.31 g/mol. Its IUPAC name is 8-anilino-1,3,7-trimethyl-9H-purin-7-ium-2,6-dione.
| Compound Name | 8-anilino-1,3,7-trimethyl-9H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 4079046 |
| Molecular Formula | C14H16N5O2+ |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 8-anilino-1,3,7-trimethyl-9H-purin-7-ium-2,6-dione |
| SMILES | Cn1c(=O)c2c([nH]c(Nc3ccccc3)[n+]2C)n(C)c1=O |
| InChI | InChI=1S/C14H15N5O2/c1-17-10-11(18(2)14(21)19(3)12(10)20)16-13(17)15-9-7-5-4-6-8-9/h4-8H,1-3H3,(H,15,16,20)/p+1 |
| InChIKey | JGHWNPZSWGAWNZ-UHFFFAOYSA-O |
| XLogP | 0.13 |
| TPSA | 75.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|