C13H19N4O4S+ — CID 5067466
2-[[1,3-dimethyl-7-(2-methylpropyl)-2,6-dioxo-9H-purin-7-ium-8-yl]sulfanyl]acetic acid (PubChem CID 5067466) has the molecular formula C13H19N4O4S+ and a molecular weight of 327.39 g/mol. Its IUPAC name is 2-[[1,3-dimethyl-7-(2-methylpropyl)-2,6-dioxo-9H-purin-7-ium-8-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[1,3-dimethyl-7-(2-methylpropyl)-2,6-dioxo-9H-purin-7-ium-8-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 5067466 |
| Molecular Formula | C13H19N4O4S+ |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 2-[[1,3-dimethyl-7-(2-methylpropyl)-2,6-dioxo-9H-purin-7-ium-8-yl]sulfanyl]acetic acid |
| SMILES | CC(C)C[n+]1c(SCC(=O)O)[nH]c2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C13H18N4O4S/c1-7(2)5-17-9-10(14-12(17)22-6-8(18)19)15(3)13(21)16(4)11(9)20/h7H,5-6H2,1-4H3,(H,18,19)/p+1 |
| InChIKey | BJXIMZSDSPMXFO-UHFFFAOYSA-O |
| XLogP | -0.31 |
| TPSA | 100.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|