C21H26N5O6+ — CID 3434244
7-[2-(3,4-dimethoxyphenyl)-2-oxoethyl]-1,3-dimethyl-8-morpholin-4-yl-9H-purin-7-ium-2,6-dione (PubChem CID 3434244) has the molecular formula C21H26N5O6+ and a molecular weight of 444.47 g/mol. Its IUPAC name is 7-[2-(3,4-dimethoxyphenyl)-2-oxoethyl]-1,3-dimethyl-8-morpholin-4-yl-9H-purin-7-ium-2,6-dione.
| Compound Name | 7-[2-(3,4-dimethoxyphenyl)-2-oxoethyl]-1,3-dimethyl-8-morpholin-4-yl-9H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 3434244 |
| Molecular Formula | C21H26N5O6+ |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 7-[2-(3,4-dimethoxyphenyl)-2-oxoethyl]-1,3-dimethyl-8-morpholin-4-yl-9H-purin-7-ium-2,6-dione |
| SMILES | COc1ccc(C(=O)C[n+]2c(N3CCOCC3)[nH]c3c2c(=O)n(C)c(=O)n3C)cc1OC |
| InChI | InChI=1S/C21H25N5O6/c1-23-18-17(19(28)24(2)21(23)29)26(20(22-18)25-7-9-32-10-8-25)12-14(27)13-5-6-15(30-3)16(11-13)31-4/h5-6,11H,7-10,12H2,1-4H3/p+1 |
| InChIKey | UFTUWRRKKYFJEE-UHFFFAOYSA-O |
| XLogP | -0.41 |
| TPSA | 111.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|