C11H11N5S — CID 134099355
1H-benzimidazol-2-ylmethyl N-cyano-N'-methylcarbamimidothioate (PubChem CID 134099355) has the molecular formula C11H11N5S and a molecular weight of 245.31 g/mol. Its IUPAC name is 1H-benzimidazol-2-ylmethyl N-cyano-N'-methylcarbamimidothioate.
| Compound Name | 1H-benzimidazol-2-ylmethyl N-cyano-N'-methylcarbamimidothioate |
|---|---|
| PubChem CID | 134099355 |
| Molecular Formula | C11H11N5S |
| Molecular Weight | 245.31 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 1H-benzimidazol-2-ylmethyl N-cyano-N'-methylcarbamimidothioate |
| SMILES | C/N=C(\NC#N)SCc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C11H11N5S/c1-13-11(14-7-12)17-6-10-15-8-4-2-3-5-9(8)16-10/h2-5H,6H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | PPSHERWDARHDAW-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 76.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|