C14H18N6S — CID 54564204
2-[2-(1H-benzimidazol-2-ylmethylsulfanyl)ethyl]-1-cyano-3-ethylguanidine (PubChem CID 54564204) has the molecular formula C14H18N6S and a molecular weight of 302.41 g/mol. Its IUPAC name is 2-[2-(1H-benzimidazol-2-ylmethylsulfanyl)ethyl]-1-cyano-3-ethylguanidine.
| Compound Name | 2-[2-(1H-benzimidazol-2-ylmethylsulfanyl)ethyl]-1-cyano-3-ethylguanidine |
|---|---|
| PubChem CID | 54564204 |
| Molecular Formula | C14H18N6S |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 2-[2-(1H-benzimidazol-2-ylmethylsulfanyl)ethyl]-1-cyano-3-ethylguanidine |
| SMILES | CCN/C(=N/CCSCc1nc2ccccc2[nH]1)NC#N |
| InChI | InChI=1S/C14H18N6S/c1-2-16-14(18-10-15)17-7-8-21-9-13-19-11-5-3-4-6-12(11)20-13/h3-6H,2,7-9H2,1H3,(H,19,20)(H2,16,17,18) |
| InChIKey | ZSRIFBSWTCDNGX-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 88.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|