C17H27N3O — CID 134099367
1-(2-hydroxyphenyl)-2-(2-methylcyclohexyl)-3-propan-2-ylguanidine (PubChem CID 134099367) has the molecular formula C17H27N3O and a molecular weight of 289.42 g/mol. Its IUPAC name is 1-(2-hydroxyphenyl)-2-(2-methylcyclohexyl)-3-propan-2-ylguanidine.
| Compound Name | 1-(2-hydroxyphenyl)-2-(2-methylcyclohexyl)-3-propan-2-ylguanidine |
|---|---|
| PubChem CID | 134099367 |
| Molecular Formula | C17H27N3O |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | 1-(2-hydroxyphenyl)-2-(2-methylcyclohexyl)-3-propan-2-ylguanidine |
| SMILES | CC(C)N/C(=N\C1CCCCC1C)Nc1ccccc1O |
| InChI | InChI=1S/C17H27N3O/c1-12(2)18-17(19-14-9-5-4-8-13(14)3)20-15-10-6-7-11-16(15)21/h6-7,10-14,21H,4-5,8-9H2,1-3H3,(H2,18,19,20) |
| InChIKey | KKLZLYMKEIZGKL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|